C35H29N3O6S — CID 19057617
N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-[3-[1-(3,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19057617) has the molecular formula C35H29N3O6S and a molecular weight of 619.70 g/mol. Its IUPAC name is N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-[3-[1-(3,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-[3-[1-(3,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19057617 |
| Molecular Formula | C35H29N3O6S |
| Molecular Weight | 619.70 g/mol |
| Exact Mass | 619.18 |
| IUPAC Name | N-[(Z)-1-(1,3-benzodioxol-5-yl)-3-[3-[1-(3,4-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1ccc(N2C(=O)CC(Sc3cccc(NC(=O)/C(=C/c4ccc5c(c4)OCO5)NC(=O)c4ccccc4)c3)C2=O)cc1C |
| InChI | InChI=1S/C35H29N3O6S/c1-21-11-13-26(15-22(21)2)38-32(39)19-31(35(38)42)45-27-10-6-9-25(18-27)36-34(41)28(37-33(40)24-7-4-3-5-8-24)16-23-12-14-29-30(17-23)44-20-43-29/h3-18,31H,19-20H2,1-2H3,(H,36,41)(H,37,40)/b28-16- |
| InChIKey | BOSUXYVBDFNFGD-NTFVMDSBSA-N |
| XLogP | 5.87 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.70 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|