C40H32ClN3O7S — CID 99679654
N-[(Z)-3-[3-[(3S)-1-[4-(4-chlorophenoxy)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 99679654) has the molecular formula C40H32ClN3O7S and a molecular weight of 734.23 g/mol. Its IUPAC name is N-[(Z)-3-[3-[(3S)-1-[4-(4-chlorophenoxy)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[(3S)-1-[4-(4-chlorophenoxy)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 99679654 |
| Molecular Formula | C40H32ClN3O7S |
| Molecular Weight | 734.23 g/mol |
| Exact Mass | 733.16 |
| IUPAC Name | N-[(Z)-3-[3-[(3S)-1-[4-(4-chlorophenoxy)phenyl]-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-1-(2,3-dimethoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2cccc(S[C@H]3CC(=O)N(c4ccc(Oc5ccc(Cl)cc5)cc4)C3=O)c2)c1OC |
| InChI | InChI=1S/C40H32ClN3O7S/c1-49-34-13-6-10-26(37(34)50-2)22-33(43-38(46)25-8-4-3-5-9-25)39(47)42-28-11-7-12-32(23-28)52-35-24-36(45)44(40(35)48)29-16-20-31(21-17-29)51-30-18-14-27(41)15-19-30/h3-23,35H,24H2,1-2H3,(H,42,47)(H,43,46)/b33-22-/t35-/m0/s1 |
| InChIKey | QTNZXJNJROBSIX-HRDPZVOISA-N |
| XLogP | 7.98 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.23 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|