C19H17ClN2O4S — CID 1243830
N-(3-chloro-4-methoxyphenyl)-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanylacetamide (PubChem CID 1243830) has the molecular formula C19H17ClN2O4S and a molecular weight of 404.88 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanylacetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 1243830 |
| Molecular Formula | C19H17ClN2O4S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-[(3S)-2,5-dioxo-1-phenylpyrrolidin-3-yl]sulfanylacetamide |
| SMILES | COc1ccc(NC(=O)CS[C@H]2CC(=O)N(c3ccccc3)C2=O)cc1Cl |
| InChI | InChI=1S/C19H17ClN2O4S/c1-26-15-8-7-12(9-14(15)20)21-17(23)11-27-16-10-18(24)22(19(16)25)13-5-3-2-4-6-13/h2-9,16H,10-11H2,1H3,(H,21,23)/t16-/m0/s1 |
| InChIKey | IQONSRRZOZMDBC-INIZCTEOSA-N |
| XLogP | 3.35 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|