C23H17Cl2N3O3S — CID 23101822
1-[4-[1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-phenylurea (PubChem CID 23101822) has the molecular formula C23H17Cl2N3O3S and a molecular weight of 486.38 g/mol. Its IUPAC name is 1-[4-[1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-phenylurea.
| Compound Name | 1-[4-[1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-phenylurea |
|---|---|
| PubChem CID | 23101822 |
| Molecular Formula | C23H17Cl2N3O3S |
| Molecular Weight | 486.38 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | 1-[4-[1-(3,4-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(SC2CC(=O)N(c3ccc(Cl)c(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C23H17Cl2N3O3S/c24-18-11-8-16(12-19(18)25)28-21(29)13-20(22(28)30)32-17-9-6-15(7-10-17)27-23(31)26-14-4-2-1-3-5-14/h1-12,20H,13H2,(H2,26,27,31) |
| InChIKey | CIRBKAORQAEWRN-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.38 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|