C24H19ClN2O3S — CID 99130000
N-[4-[(3R)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-2-phenylacetamide (PubChem CID 99130000) has the molecular formula C24H19ClN2O3S and a molecular weight of 450.95 g/mol. Its IUPAC name is N-[4-[(3R)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-2-phenylacetamide.
| Compound Name | N-[4-[(3R)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 99130000 |
| Molecular Formula | C24H19ClN2O3S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | N-[4-[(3R)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccc(S[C@@H]2CC(=O)N(c3cccc(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C24H19ClN2O3S/c25-17-7-4-8-19(14-17)27-23(29)15-21(24(27)30)31-20-11-9-18(10-12-20)26-22(28)13-16-5-2-1-3-6-16/h1-12,14,21H,13,15H2,(H,26,28)/t21-/m1/s1 |
| InChIKey | NSBSGUVCTCOZFM-OAQYLSRUSA-N |
| XLogP | 4.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|