C27H26N2O3S — CID 19059324
N-[4-[1-(2-ethyl-6-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-2-phenylacetamide (PubChem CID 19059324) has the molecular formula C27H26N2O3S and a molecular weight of 458.58 g/mol. Its IUPAC name is N-[4-[1-(2-ethyl-6-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-2-phenylacetamide.
| Compound Name | N-[4-[1-(2-ethyl-6-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 19059324 |
| Molecular Formula | C27H26N2O3S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | N-[4-[1-(2-ethyl-6-methylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-2-phenylacetamide |
| SMILES | CCc1cccc(C)c1N1C(=O)CC(Sc2ccc(NC(=O)Cc3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C27H26N2O3S/c1-3-20-11-7-8-18(2)26(20)29-25(31)17-23(27(29)32)33-22-14-12-21(13-15-22)28-24(30)16-19-9-5-4-6-10-19/h4-15,23H,3,16-17H2,1-2H3,(H,28,30) |
| InChIKey | RSTDUACLYBJFTJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|