C22H20N2O5S — CID 22778093
(E)-4-[4-[1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-4-oxobut-2-enoic acid (PubChem CID 22778093) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is (E)-4-[4-[1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[4-[1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 22778093 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | (E)-4-[4-[1-(2,6-dimethylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylanilino]-4-oxobut-2-enoic acid |
| SMILES | Cc1cccc(C)c1N1C(=O)CC(Sc2ccc(NC(=O)/C=C/C(=O)O)cc2)C1=O |
| InChI | InChI=1S/C22H20N2O5S/c1-13-4-3-5-14(2)21(13)24-19(26)12-17(22(24)29)30-16-8-6-15(7-9-16)23-18(25)10-11-20(27)28/h3-11,17H,12H2,1-2H3,(H,23,25)(H,27,28)/b11-10+ |
| InChIKey | MOPSGUQYMIQBMV-ZHACJKMWSA-N |
| XLogP | 3.31 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|