C28H26N2O3S — CID 23096670
(E)-N-[4-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]sulfanylphenyl]-3-phenylprop-2-enamide (PubChem CID 23096670) has the molecular formula C28H26N2O3S and a molecular weight of 470.59 g/mol. Its IUPAC name is (E)-N-[4-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]sulfanylphenyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[4-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]sulfanylphenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 23096670 |
| Molecular Formula | C28H26N2O3S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | (E)-N-[4-[2,5-dioxo-1-(4-propan-2-ylphenyl)pyrrolidin-3-yl]sulfanylphenyl]-3-phenylprop-2-enamide |
| SMILES | CC(C)c1ccc(N2C(=O)CC(Sc3ccc(NC(=O)/C=C/c4ccccc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C28H26N2O3S/c1-19(2)21-9-13-23(14-10-21)30-27(32)18-25(28(30)33)34-24-15-11-22(12-16-24)29-26(31)17-8-20-6-4-3-5-7-20/h3-17,19,25H,18H2,1-2H3,(H,29,31)/b17-8+ |
| InChIKey | OTIWKAMOKZOTGT-CAOOACKPSA-N |
| XLogP | 5.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|