C27H19ClN2O3S — CID 23098692
N-[4-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]naphthalene-2-carboxamide (PubChem CID 23098692) has the molecular formula C27H19ClN2O3S and a molecular weight of 486.98 g/mol. Its IUPAC name is N-[4-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]naphthalene-2-carboxamide.
| Compound Name | N-[4-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 23098692 |
| Molecular Formula | C27H19ClN2O3S |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | N-[4-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]naphthalene-2-carboxamide |
| SMILES | O=C(Nc1ccc(SC2CC(=O)N(c3ccc(Cl)cc3)C2=O)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H19ClN2O3S/c28-20-7-11-22(12-8-20)30-25(31)16-24(27(30)33)34-23-13-9-21(10-14-23)29-26(32)19-6-5-17-3-1-2-4-18(17)15-19/h1-15,24H,16H2,(H,29,32) |
| InChIKey | AFGBZRHGAWXRLS-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|