C23H15Cl3N2O3S — CID 23100634
2,4-dichloro-N-[4-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]benzamide (PubChem CID 23100634) has the molecular formula C23H15Cl3N2O3S and a molecular weight of 505.81 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 23100634 |
| Molecular Formula | C23H15Cl3N2O3S |
| Molecular Weight | 505.81 g/mol |
| Exact Mass | 503.99 |
| IUPAC Name | 2,4-dichloro-N-[4-[1-(4-chlorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]benzamide |
| SMILES | O=C(Nc1ccc(SC2CC(=O)N(c3ccc(Cl)cc3)C2=O)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H15Cl3N2O3S/c24-13-1-6-16(7-2-13)28-21(29)12-20(23(28)31)32-17-8-4-15(5-9-17)27-22(30)18-10-3-14(25)11-19(18)26/h1-11,20H,12H2,(H,27,30) |
| InChIKey | HJQMKDMIAFUWOU-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.81 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|