C24H17IN2O5S — CID 99122418
2-[[4-[(3S)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 99122418) has the molecular formula C24H17IN2O5S and a molecular weight of 572.38 g/mol. Its IUPAC name is 2-[[4-[(3S)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[4-[(3S)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 99122418 |
| Molecular Formula | C24H17IN2O5S |
| Molecular Weight | 572.38 g/mol |
| Exact Mass | 571.99 |
| IUPAC Name | 2-[[4-[(3S)-1-(4-iodophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)Nc1ccc(S[C@H]2CC(=O)N(c3ccc(I)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H17IN2O5S/c25-14-5-9-16(10-6-14)27-21(28)13-20(23(27)30)33-17-11-7-15(8-12-17)26-22(29)18-3-1-2-4-19(18)24(31)32/h1-12,20H,13H2,(H,26,29)(H,31,32)/t20-/m0/s1 |
| InChIKey | DGVLKFQGOOFGHS-FQEVSTJZSA-N |
| XLogP | 4.67 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|