C28H22N2O9S — CID 23101843
2-[[4-[1-(4-ethoxycarbonylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]terephthalic acid (PubChem CID 23101843) has the molecular formula C28H22N2O9S and a molecular weight of 562.56 g/mol. Its IUPAC name is 2-[[4-[1-(4-ethoxycarbonylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]terephthalic acid.
| Compound Name | 2-[[4-[1-(4-ethoxycarbonylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]terephthalic acid |
|---|---|
| PubChem CID | 23101843 |
| Molecular Formula | C28H22N2O9S |
| Molecular Weight | 562.56 g/mol |
| Exact Mass | 562.10 |
| IUPAC Name | 2-[[4-[1-(4-ethoxycarbonylphenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]carbamoyl]terephthalic acid |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(Sc3ccc(NC(=O)c4cc(C(=O)O)ccc4C(=O)O)cc3)C2=O)cc1 |
| InChI | InChI=1S/C28H22N2O9S/c1-2-39-28(38)15-3-8-18(9-4-15)30-23(31)14-22(25(30)33)40-19-10-6-17(7-11-19)29-24(32)21-13-16(26(34)35)5-12-20(21)27(36)37/h3-13,22H,2,14H2,1H3,(H,29,32)(H,34,35)(H,36,37) |
| InChIKey | VAUSKJMJYZSLTM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 167.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|