C25H22N2O6S2 — CID 23101041
ethyl 4-[3-[4-(benzenesulfonamido)phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 23101041) has the molecular formula C25H22N2O6S2 and a molecular weight of 510.59 g/mol. Its IUPAC name is ethyl 4-[3-[4-(benzenesulfonamido)phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[4-(benzenesulfonamido)phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 23101041 |
| Molecular Formula | C25H22N2O6S2 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | ethyl 4-[3-[4-(benzenesulfonamido)phenyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)CC(Sc3ccc(NS(=O)(=O)c4ccccc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H22N2O6S2/c1-2-33-25(30)17-8-12-19(13-9-17)27-23(28)16-22(24(27)29)34-20-14-10-18(11-15-20)26-35(31,32)21-6-4-3-5-7-21/h3-15,22,26H,2,16H2,1H3 |
| InChIKey | JUTAXYUUVMQLDG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|