C21H17N3O5S3 — CID 23098766
4-[2,5-dioxo-3-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylpyrrolidin-1-yl]benzamide (PubChem CID 23098766) has the molecular formula C21H17N3O5S3 and a molecular weight of 487.58 g/mol. Its IUPAC name is 4-[2,5-dioxo-3-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylpyrrolidin-1-yl]benzamide.
| Compound Name | 4-[2,5-dioxo-3-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylpyrrolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 23098766 |
| Molecular Formula | C21H17N3O5S3 |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | 4-[2,5-dioxo-3-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylpyrrolidin-1-yl]benzamide |
| SMILES | NC(=O)c1ccc(N2C(=O)CC(Sc3ccc(NS(=O)(=O)c4cccs4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H17N3O5S3/c22-20(26)13-3-7-15(8-4-13)24-18(25)12-17(21(24)27)31-16-9-5-14(6-10-16)23-32(28,29)19-2-1-11-30-19/h1-11,17,23H,12H2,(H2,22,26) |
| InChIKey | LVHSZQLTQZFCBH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|