C20H15BrN2O4S3 — CID 21167700
N-[4-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]thiophene-2-sulfonamide (PubChem CID 21167700) has the molecular formula C20H15BrN2O4S3 and a molecular weight of 523.46 g/mol. Its IUPAC name is N-[4-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 21167700 |
| Molecular Formula | C20H15BrN2O4S3 |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 521.94 |
| IUPAC Name | N-[4-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]thiophene-2-sulfonamide |
| SMILES | O=C1CC(Sc2ccc(NS(=O)(=O)c3cccs3)cc2)C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H15BrN2O4S3/c21-13-3-7-15(8-4-13)23-18(24)12-17(20(23)25)29-16-9-5-14(6-10-16)22-30(26,27)19-2-1-11-28-19/h1-11,17,22H,12H2 |
| InChIKey | BATHITIHGCKZPJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|