C24H19BrN2O4S — CID 23101109
N-[4-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-methoxybenzamide (PubChem CID 23101109) has the molecular formula C24H19BrN2O4S and a molecular weight of 511.40 g/mol. Its IUPAC name is N-[4-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-methoxybenzamide.
| Compound Name | N-[4-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 23101109 |
| Molecular Formula | C24H19BrN2O4S |
| Molecular Weight | 511.40 g/mol |
| Exact Mass | 510.02 |
| IUPAC Name | N-[4-[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylphenyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(SC3CC(=O)N(c4ccc(Br)cc4)C3=O)cc2)c1 |
| InChI | InChI=1S/C24H19BrN2O4S/c1-31-19-4-2-3-15(13-19)23(29)26-17-7-11-20(12-8-17)32-21-14-22(28)27(24(21)30)18-9-5-16(25)6-10-18/h2-13,21H,14H2,1H3,(H,26,29) |
| InChIKey | LDQJUYTYCGWGON-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|