C16H10BrCl2NO2S — CID 1206931
(3S)-3-(4-bromophenyl)sulfanyl-1-(3,5-dichlorophenyl)pyrrolidine-2,5-dione (PubChem CID 1206931) has the molecular formula C16H10BrCl2NO2S and a molecular weight of 431.14 g/mol. Its IUPAC name is (3S)-3-(4-bromophenyl)sulfanyl-1-(3,5-dichlorophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(4-bromophenyl)sulfanyl-1-(3,5-dichlorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1206931 |
| Molecular Formula | C16H10BrCl2NO2S |
| Molecular Weight | 431.14 g/mol |
| Exact Mass | 428.90 |
| IUPAC Name | (3S)-3-(4-bromophenyl)sulfanyl-1-(3,5-dichlorophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H](Sc2ccc(Br)cc2)C(=O)N1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H10BrCl2NO2S/c17-9-1-3-13(4-2-9)23-14-8-15(21)20(16(14)22)12-6-10(18)5-11(19)7-12/h1-7,14H,8H2/t14-/m0/s1 |
| InChIKey | OSFYLSHUWZASFG-AWEZNQCLSA-N |
| XLogP | 5.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.14 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|