C17H13Cl2NO2S — CID 1278127
(3S)-1-(3,5-dichlorophenyl)-3-(4-methylphenyl)sulfanylpyrrolidine-2,5-dione (PubChem CID 1278127) has the molecular formula C17H13Cl2NO2S and a molecular weight of 366.27 g/mol. Its IUPAC name is (3S)-1-(3,5-dichlorophenyl)-3-(4-methylphenyl)sulfanylpyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(3,5-dichlorophenyl)-3-(4-methylphenyl)sulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1278127 |
| Molecular Formula | C17H13Cl2NO2S |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | (3S)-1-(3,5-dichlorophenyl)-3-(4-methylphenyl)sulfanylpyrrolidine-2,5-dione |
| SMILES | Cc1ccc(S[C@H]2CC(=O)N(c3cc(Cl)cc(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C17H13Cl2NO2S/c1-10-2-4-14(5-3-10)23-15-9-16(21)20(17(15)22)13-7-11(18)6-12(19)8-13/h2-8,15H,9H2,1H3/t15-/m0/s1 |
| InChIKey | NTSCLTBGDRNNOH-HNNXBMFYSA-N |
| XLogP | 4.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|