C13H13N5O2S — CID 2036009
(3R)-1-(4-methylphenyl)-3-(1-methyltetrazol-5-yl)sulfanylpyrrolidine-2,5-dione (PubChem CID 2036009) has the molecular formula C13H13N5O2S and a molecular weight of 303.35 g/mol. Its IUPAC name is (3R)-1-(4-methylphenyl)-3-(1-methyltetrazol-5-yl)sulfanylpyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(4-methylphenyl)-3-(1-methyltetrazol-5-yl)sulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2036009 |
| Molecular Formula | C13H13N5O2S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (3R)-1-(4-methylphenyl)-3-(1-methyltetrazol-5-yl)sulfanylpyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C[C@@H](Sc3nnnn3C)C2=O)cc1 |
| InChI | InChI=1S/C13H13N5O2S/c1-8-3-5-9(6-4-8)18-11(19)7-10(12(18)20)21-13-14-15-16-17(13)2/h3-6,10H,7H2,1-2H3/t10-/m1/s1 |
| InChIKey | YDWSYEOBQAXQHW-SNVBAGLBSA-N |
| XLogP | 0.94 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|