C18H14N2O2S2 — CID 1038336
(3S)-3-(1,3-benzothiazol-2-ylsulfanyl)-1-(4-methylphenyl)pyrrolidine-2,5-dione (PubChem CID 1038336) has the molecular formula C18H14N2O2S2 and a molecular weight of 354.46 g/mol. Its IUPAC name is (3S)-3-(1,3-benzothiazol-2-ylsulfanyl)-1-(4-methylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(1,3-benzothiazol-2-ylsulfanyl)-1-(4-methylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1038336 |
| Molecular Formula | C18H14N2O2S2 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | (3S)-3-(1,3-benzothiazol-2-ylsulfanyl)-1-(4-methylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C[C@H](Sc3nc4ccccc4s3)C2=O)cc1 |
| InChI | InChI=1S/C18H14N2O2S2/c1-11-6-8-12(9-7-11)20-16(21)10-15(17(20)22)24-18-19-13-4-2-3-5-14(13)23-18/h2-9,15H,10H2,1H3/t15-/m0/s1 |
| InChIKey | KTSGGFREOYZZAP-HNNXBMFYSA-N |
| XLogP | 4.03 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|