C17H10Cl2N2O2S2 — CID 1045448
(3S)-3-(1,3-benzothiazol-2-ylsulfanyl)-1-(2,4-dichlorophenyl)pyrrolidine-2,5-dione (PubChem CID 1045448) has the molecular formula C17H10Cl2N2O2S2 and a molecular weight of 409.32 g/mol. Its IUPAC name is (3S)-3-(1,3-benzothiazol-2-ylsulfanyl)-1-(2,4-dichlorophenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(1,3-benzothiazol-2-ylsulfanyl)-1-(2,4-dichlorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1045448 |
| Molecular Formula | C17H10Cl2N2O2S2 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 407.96 |
| IUPAC Name | (3S)-3-(1,3-benzothiazol-2-ylsulfanyl)-1-(2,4-dichlorophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H](Sc2nc3ccccc3s2)C(=O)N1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H10Cl2N2O2S2/c18-9-5-6-12(10(19)7-9)21-15(22)8-14(16(21)23)25-17-20-11-3-1-2-4-13(11)24-17/h1-7,14H,8H2/t14-/m0/s1 |
| InChIKey | PJOXULQBGFAZOV-AWEZNQCLSA-N |
| XLogP | 5.03 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|