C19H15N3O5S3 — CID 3343492
N-[4-[3-(1,3-benzothiazol-2-ylsulfanyl)-2,5-dioxopyrrolidin-1-yl]phenyl]sulfonylacetamide (PubChem CID 3343492) has the molecular formula C19H15N3O5S3 and a molecular weight of 461.55 g/mol. Its IUPAC name is N-[4-[3-(1,3-benzothiazol-2-ylsulfanyl)-2,5-dioxopyrrolidin-1-yl]phenyl]sulfonylacetamide.
| Compound Name | N-[4-[3-(1,3-benzothiazol-2-ylsulfanyl)-2,5-dioxopyrrolidin-1-yl]phenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 3343492 |
| Molecular Formula | C19H15N3O5S3 |
| Molecular Weight | 461.55 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | N-[4-[3-(1,3-benzothiazol-2-ylsulfanyl)-2,5-dioxopyrrolidin-1-yl]phenyl]sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(N2C(=O)CC(Sc3nc4ccccc4s3)C2=O)cc1 |
| InChI | InChI=1S/C19H15N3O5S3/c1-11(23)21-30(26,27)13-8-6-12(7-9-13)22-17(24)10-16(18(22)25)29-19-20-14-4-2-3-5-15(14)28-19/h2-9,16H,10H2,1H3,(H,21,23) |
| InChIKey | HXNXOGLONLYGJB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.55 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|