C28H19N3O4S2 — CID 163532213
1-[4-[[4-[3-(1,3-benzothiazol-2-ylsulfanyl)-2,5-dioxopyrrolidin-1-yl]phenyl]methyl]phenyl]pyrrole-2,5-dione (PubChem CID 163532213) has the molecular formula C28H19N3O4S2 and a molecular weight of 525.61 g/mol. Its IUPAC name is 1-[4-[[4-[3-(1,3-benzothiazol-2-ylsulfanyl)-2,5-dioxopyrrolidin-1-yl]phenyl]methyl]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[[4-[3-(1,3-benzothiazol-2-ylsulfanyl)-2,5-dioxopyrrolidin-1-yl]phenyl]methyl]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 163532213 |
| Molecular Formula | C28H19N3O4S2 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | 1-[4-[[4-[3-(1,3-benzothiazol-2-ylsulfanyl)-2,5-dioxopyrrolidin-1-yl]phenyl]methyl]phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1ccc(Cc2ccc(N3C(=O)CC(Sc4nc5ccccc5s4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C28H19N3O4S2/c32-24-13-14-25(33)30(24)19-9-5-17(6-10-19)15-18-7-11-20(12-8-18)31-26(34)16-23(27(31)35)37-28-29-21-3-1-2-4-22(21)36-28/h1-14,23H,15-16H2 |
| InChIKey | DTYAGOHQUGHDPF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|