C27H21N3O5 — CID 59562100
1-[4-[[4-[3-(4-hydroxyanilino)-2,5-dioxopyrrolidin-1-yl]phenyl]methyl]phenyl]pyrrole-2,5-dione (PubChem CID 59562100) has the molecular formula C27H21N3O5 and a molecular weight of 467.48 g/mol. Its IUPAC name is 1-[4-[[4-[3-(4-hydroxyanilino)-2,5-dioxopyrrolidin-1-yl]phenyl]methyl]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[[4-[3-(4-hydroxyanilino)-2,5-dioxopyrrolidin-1-yl]phenyl]methyl]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 59562100 |
| Molecular Formula | C27H21N3O5 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 1-[4-[[4-[3-(4-hydroxyanilino)-2,5-dioxopyrrolidin-1-yl]phenyl]methyl]phenyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1c1ccc(Cc2ccc(N3C(=O)CC(Nc4ccc(O)cc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C27H21N3O5/c31-22-11-5-19(6-12-22)28-23-16-26(34)30(27(23)35)21-9-3-18(4-10-21)15-17-1-7-20(8-2-17)29-24(32)13-14-25(29)33/h1-14,23,28,31H,15-16H2 |
| InChIKey | IQCZLAGMIPVBKE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|