C24H30N2O2 — CID 98395221
(3R)-3-(4-butylanilino)-1-(4-butylphenyl)pyrrolidine-2,5-dione (PubChem CID 98395221) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is (3R)-3-(4-butylanilino)-1-(4-butylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(4-butylanilino)-1-(4-butylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98395221 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (3R)-3-(4-butylanilino)-1-(4-butylphenyl)pyrrolidine-2,5-dione |
| SMILES | CCCCc1ccc(N[C@@H]2CC(=O)N(c3ccc(CCCC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H30N2O2/c1-3-5-7-18-9-13-20(14-10-18)25-22-17-23(27)26(24(22)28)21-15-11-19(12-16-21)8-6-4-2/h9-16,22,25H,3-8,17H2,1-2H3/t22-/m1/s1 |
| InChIKey | HWXJUUICAMYNOE-JOCHJYFZSA-N |
| XLogP | 5.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|