C20H21FN2O2 — CID 138958737
3-(4-butylanilino)-1-(2-fluorophenyl)pyrrolidine-2,5-dione (PubChem CID 138958737) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is 3-(4-butylanilino)-1-(2-fluorophenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-(4-butylanilino)-1-(2-fluorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 138958737 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3-(4-butylanilino)-1-(2-fluorophenyl)pyrrolidine-2,5-dione |
| SMILES | CCCCc1ccc(NC2CC(=O)N(c3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C20H21FN2O2/c1-2-3-6-14-9-11-15(12-10-14)22-17-13-19(24)23(20(17)25)18-8-5-4-7-16(18)21/h4-5,7-12,17,22H,2-3,6,13H2,1H3 |
| InChIKey | MFOHKOQPNBGIQX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|