C20H22N2O2 — CID 51860063
(3S)-3-(2,6-dimethylanilino)-1-(4-ethylphenyl)pyrrolidine-2,5-dione (PubChem CID 51860063) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is (3S)-3-(2,6-dimethylanilino)-1-(4-ethylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-(2,6-dimethylanilino)-1-(4-ethylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 51860063 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (3S)-3-(2,6-dimethylanilino)-1-(4-ethylphenyl)pyrrolidine-2,5-dione |
| SMILES | CCc1ccc(N2C(=O)C[C@H](Nc3c(C)cccc3C)C2=O)cc1 |
| InChI | InChI=1S/C20H22N2O2/c1-4-15-8-10-16(11-9-15)22-18(23)12-17(20(22)24)21-19-13(2)6-5-7-14(19)3/h5-11,17,21H,4,12H2,1-3H3/t17-/m0/s1 |
| InChIKey | AKWOWYIYFBVPPU-KRWDZBQOSA-N |
| XLogP | 3.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|