C19H18N2O4 — CID 92523283
4-[(3R)-3-(2,6-dimethylanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid (PubChem CID 92523283) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 4-[(3R)-3-(2,6-dimethylanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid.
| Compound Name | 4-[(3R)-3-(2,6-dimethylanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 92523283 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 4-[(3R)-3-(2,6-dimethylanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid |
| SMILES | Cc1cccc(C)c1N[C@@H]1CC(=O)N(c2ccc(C(=O)O)cc2)C1=O |
| InChI | InChI=1S/C19H18N2O4/c1-11-4-3-5-12(2)17(11)20-15-10-16(22)21(18(15)23)14-8-6-13(7-9-14)19(24)25/h3-9,15,20H,10H2,1-2H3,(H,24,25)/t15-/m1/s1 |
| InChIKey | BJDPYNREXBCVHR-OAHLLOKOSA-N |
| XLogP | 2.75 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|