C18H16N2O5 — CID 43827237
4-[3-(3-methoxyanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid (PubChem CID 43827237) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is 4-[3-(3-methoxyanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid.
| Compound Name | 4-[3-(3-methoxyanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 43827237 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 4-[3-(3-methoxyanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid |
| SMILES | COc1cccc(NC2CC(=O)N(c3ccc(C(=O)O)cc3)C2=O)c1 |
| InChI | InChI=1S/C18H16N2O5/c1-25-14-4-2-3-12(9-14)19-15-10-16(21)20(17(15)22)13-7-5-11(6-8-13)18(23)24/h2-9,15,19H,10H2,1H3,(H,23,24) |
| InChIKey | ZHCBUJHUZWCGDX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|