C18H16N2O4 — CID 43827259
3-[3-(2-methylanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid (PubChem CID 43827259) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 3-[3-(2-methylanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid.
| Compound Name | 3-[3-(2-methylanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 43827259 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 3-[3-(2-methylanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid |
| SMILES | Cc1ccccc1NC1CC(=O)N(c2cccc(C(=O)O)c2)C1=O |
| InChI | InChI=1S/C18H16N2O4/c1-11-5-2-3-8-14(11)19-15-10-16(21)20(17(15)22)13-7-4-6-12(9-13)18(23)24/h2-9,15,19H,10H2,1H3,(H,23,24) |
| InChIKey | WLXHSYFDIBTSLK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|