About 3-[3-(2-nitroanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid
3-[3-(2-nitroanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid (PubChem CID 43860735) has the molecular formula C17H13N3O6
and a molecular weight of 355.31 g/mol. Its IUPAC name is 3-[3-(2-nitroanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid.
Molecular Properties
| Compound Name | 3-[3-(2-nitroanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid |
| PubChem CID | 43860735 |
| Molecular Formula | C17H13N3O6 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 3-[3-(2-nitroanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(N2C(=O)CC(Nc3ccccc3[N+](=O)[O-])C2=O)c1 |
| InChI | InChI=1S/C17H13N3O6/c21-15-9-13(18-12-6-1-2-7-14(12)20(25)26)16(22)19(15)11-5-3-4-10(8-11)17(23)24/h1-8,13,18H,9H2,(H,23,24) |
| InChIKey | FYAIWVDVSUZBEC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(2-nitroanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2-nitroanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid?
The IUPAC name of 3-[3-(2-nitroanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid (CID 43860735) is 3-[3-(2-nitroanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid.
What is the SMILES notation for 3-[3-(2-nitroanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid?
The canonical SMILES for 3-[3-(2-nitroanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid is O=C(O)c1cccc(N2C(=O)CC(Nc3ccccc3[N+](=O)[O-])C2=O)c1.
What is the InChIKey of 3-[3-(2-nitroanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid?
The InChIKey is FYAIWVDVSUZBEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O6/c21-15-9-13(18-12-6-1-2-7-14(12)20(25)26)16(22)19(15)11-5-3-4-10(8-11)17(23)24/h1-8,13,18H,9H2,(H,23,24).
What are the key properties of 3-[3-(2-nitroanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid?
3-[3-(2-nitroanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid has a molecular weight of 355.31 g/mol, XLogP of 2.04, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2-nitroanilino)-2,5-dioxopyrrolidin-1-yl]benzoic acid is sourced from PubChem (CID 43860735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).