C19H15N5O6S — CID 7098928
3-[(3S)-3-[N'-[(Z)-(2-nitrophenyl)methylideneamino]carbamimidoyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoic acid (PubChem CID 7098928) has the molecular formula C19H15N5O6S and a molecular weight of 441.43 g/mol. Its IUPAC name is 3-[(3S)-3-[N'-[(Z)-(2-nitrophenyl)methylideneamino]carbamimidoyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoic acid.
| Compound Name | 3-[(3S)-3-[N'-[(Z)-(2-nitrophenyl)methylideneamino]carbamimidoyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 7098928 |
| Molecular Formula | C19H15N5O6S |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 3-[(3S)-3-[N'-[(Z)-(2-nitrophenyl)methylideneamino]carbamimidoyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoic acid |
| SMILES | NC(=N/N=C\c1ccccc1[N+](=O)[O-])S[C@H]1CC(=O)N(c2cccc(C(=O)O)c2)C1=O |
| InChI | InChI=1S/C19H15N5O6S/c20-19(22-21-10-12-4-1-2-7-14(12)24(29)30)31-15-9-16(25)23(17(15)26)13-6-3-5-11(8-13)18(27)28/h1-8,10,15H,9H2,(H2,20,22)(H,27,28)/b21-10-/t15-/m0/s1 |
| InChIKey | YLKMXWHHMNGWCG-UNUHRMFVSA-N |
| XLogP | 2.01 |
| TPSA | 168.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|