C21H20N5O4S- — CID 7083995
3-[(3S)-3-[N'-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]carbamimidoyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 7083995) has the molecular formula C21H20N5O4S- and a molecular weight of 438.49 g/mol. Its IUPAC name is 3-[(3S)-3-[N'-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]carbamimidoyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | 3-[(3S)-3-[N'-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]carbamimidoyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 7083995 |
| Molecular Formula | C21H20N5O4S- |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 3-[(3S)-3-[N'-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]carbamimidoyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CN(C)c1ccc(/C=N\N=C(N)S[C@H]2CC(=O)N(c3cccc(C(=O)[O-])c3)C2=O)cc1 |
| InChI | InChI=1S/C21H21N5O4S/c1-25(2)15-8-6-13(7-9-15)12-23-24-21(22)31-17-11-18(27)26(19(17)28)16-5-3-4-14(10-16)20(29)30/h3-10,12,17H,11H2,1-2H3,(H2,22,24)(H,29,30)/p-1/b23-12-/t17-/m0/s1 |
| InChIKey | KXMOXSOZVRRMQX-QWUOEIFBSA-M |
| XLogP | 0.83 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|