C18H14N6O6S — CID 126468766
[1-(3-nitrophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(E)-(3-nitrophenyl)methylideneamino]carbamimidothioate (PubChem CID 126468766) has the molecular formula C18H14N6O6S and a molecular weight of 442.41 g/mol. Its IUPAC name is [1-(3-nitrophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(E)-(3-nitrophenyl)methylideneamino]carbamimidothioate.
| Compound Name | [1-(3-nitrophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(E)-(3-nitrophenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 126468766 |
| Molecular Formula | C18H14N6O6S |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | [1-(3-nitrophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(E)-(3-nitrophenyl)methylideneamino]carbamimidothioate |
| SMILES | N/C(=N\N=C\c1cccc([N+](=O)[O-])c1)SC1CC(=O)N(c2cccc([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C18H14N6O6S/c19-18(21-20-10-11-3-1-5-13(7-11)23(27)28)31-15-9-16(25)22(17(15)26)12-4-2-6-14(8-12)24(29)30/h1-8,10,15H,9H2,(H2,19,21)/b20-10+ |
| InChIKey | SZKUSDNLAVRFBT-KEBDBYFISA-N |
| XLogP | 2.22 |
| TPSA | 174.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|