C19H15BrN4O4S — CID 3798270
[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl] N'-(1,3-benzodioxol-5-ylmethylideneamino)carbamimidothioate (PubChem CID 3798270) has the molecular formula C19H15BrN4O4S and a molecular weight of 475.32 g/mol. Its IUPAC name is [1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl] N'-(1,3-benzodioxol-5-ylmethylideneamino)carbamimidothioate.
| Compound Name | [1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl] N'-(1,3-benzodioxol-5-ylmethylideneamino)carbamimidothioate |
|---|---|
| PubChem CID | 3798270 |
| Molecular Formula | C19H15BrN4O4S |
| Molecular Weight | 475.32 g/mol |
| Exact Mass | 474.00 |
| IUPAC Name | [1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl] N'-(1,3-benzodioxol-5-ylmethylideneamino)carbamimidothioate |
| SMILES | NC(=NN=Cc1ccc2c(c1)OCO2)SC1CC(=O)N(c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C19H15BrN4O4S/c20-12-2-4-13(5-3-12)24-17(25)8-16(18(24)26)29-19(21)23-22-9-11-1-6-14-15(7-11)28-10-27-14/h1-7,9,16H,8,10H2,(H2,21,23) |
| InChIKey | MDLZBCVNQODELE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 106.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|