C22H24N4O5S — CID 136734113
[(3S)-1-(4-butoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-(3,4-dihydroxyphenyl)methylideneamino]carbamimidothioate (PubChem CID 136734113) has the molecular formula C22H24N4O5S and a molecular weight of 456.52 g/mol. Its IUPAC name is [(3S)-1-(4-butoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-(3,4-dihydroxyphenyl)methylideneamino]carbamimidothioate.
| Compound Name | [(3S)-1-(4-butoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-(3,4-dihydroxyphenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 136734113 |
| Molecular Formula | C22H24N4O5S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | [(3S)-1-(4-butoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-(3,4-dihydroxyphenyl)methylideneamino]carbamimidothioate |
| SMILES | CCCCOc1ccc(N2C(=O)C[C@H](SC(N)=N/N=C\c3ccc(O)c(O)c3)C2=O)cc1 |
| InChI | InChI=1S/C22H24N4O5S/c1-2-3-10-31-16-7-5-15(6-8-16)26-20(29)12-19(21(26)30)32-22(23)25-24-13-14-4-9-17(27)18(28)11-14/h4-9,11,13,19,27-28H,2-3,10,12H2,1H3,(H2,23,25)/b24-13-/t19-/m0/s1 |
| InChIKey | UFPDTFMODRGZGI-HTAGGTJDSA-N |
| XLogP | 2.99 |
| TPSA | 137.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|