C23H21N5O3S — CID 3367785
[1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-(quinolin-4-ylmethylideneamino)carbamimidothioate (PubChem CID 3367785) has the molecular formula C23H21N5O3S and a molecular weight of 447.52 g/mol. Its IUPAC name is [1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-(quinolin-4-ylmethylideneamino)carbamimidothioate.
| Compound Name | [1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-(quinolin-4-ylmethylideneamino)carbamimidothioate |
|---|---|
| PubChem CID | 3367785 |
| Molecular Formula | C23H21N5O3S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | [1-(4-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-(quinolin-4-ylmethylideneamino)carbamimidothioate |
| SMILES | CCOc1ccc(N2C(=O)CC(SC(N)=NN=Cc3ccnc4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C23H21N5O3S/c1-2-31-17-9-7-16(8-10-17)28-21(29)13-20(22(28)30)32-23(24)27-26-14-15-11-12-25-19-6-4-3-5-18(15)19/h3-12,14,20H,2,13H2,1H3,(H2,24,27) |
| InChIKey | SABKBXSAUVSONV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|