C22H19N5O3S — CID 12004571
[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-(quinolin-4-ylmethylideneamino)carbamimidothioate (PubChem CID 12004571) has the molecular formula C22H19N5O3S and a molecular weight of 433.49 g/mol. Its IUPAC name is [1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-(quinolin-4-ylmethylideneamino)carbamimidothioate.
| Compound Name | [1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-(quinolin-4-ylmethylideneamino)carbamimidothioate |
|---|---|
| PubChem CID | 12004571 |
| Molecular Formula | C22H19N5O3S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | [1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-(quinolin-4-ylmethylideneamino)carbamimidothioate |
| SMILES | COc1ccc(N2C(=O)CC(S/C(N)=N/N=Cc3ccnc4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C22H19N5O3S/c1-30-16-8-6-15(7-9-16)27-20(28)12-19(21(27)29)31-22(23)26-25-13-14-10-11-24-18-5-3-2-4-17(14)18/h2-11,13,19H,12H2,1H3,(H2,23,26) |
| InChIKey | RVISYDCWEFTQPC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|