C18H14Br2N4O2S — CID 3089468
[1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(4-bromophenyl)methylideneamino]carbamimidothioate (PubChem CID 3089468) has the molecular formula C18H14Br2N4O2S and a molecular weight of 510.21 g/mol. Its IUPAC name is [1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(4-bromophenyl)methylideneamino]carbamimidothioate.
| Compound Name | [1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(4-bromophenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 3089468 |
| Molecular Formula | C18H14Br2N4O2S |
| Molecular Weight | 510.21 g/mol |
| Exact Mass | 507.92 |
| IUPAC Name | [1-(4-bromophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(4-bromophenyl)methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1ccc(Br)cc1)SC1CC(=O)N(c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C18H14Br2N4O2S/c19-12-3-1-11(2-4-12)10-22-23-18(21)27-15-9-16(25)24(17(15)26)14-7-5-13(20)6-8-14/h1-8,10,15H,9H2,(H2,21,23) |
| InChIKey | OKPQLBHKXGMGMD-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.21 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|