C18H14FN5O4S — CID 27862900
[(3S)-1-(3-nitrophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate (PubChem CID 27862900) has the molecular formula C18H14FN5O4S and a molecular weight of 415.41 g/mol. Its IUPAC name is [(3S)-1-(3-nitrophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate.
| Compound Name | [(3S)-1-(3-nitrophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 27862900 |
| Molecular Formula | C18H14FN5O4S |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | [(3S)-1-(3-nitrophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate |
| SMILES | NC(=N/N=C\c1ccccc1F)S[C@H]1CC(=O)N(c2cccc([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C18H14FN5O4S/c19-14-7-2-1-4-11(14)10-21-22-18(20)29-15-9-16(25)23(17(15)26)12-5-3-6-13(8-12)24(27)28/h1-8,10,15H,9H2,(H2,20,22)/b21-10-/t15-/m0/s1 |
| InChIKey | OWSGZPBDJXYISN-UNUHRMFVSA-N |
| XLogP | 2.45 |
| TPSA | 131.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|