C17H14N4O4S2 — CID 7098922
3-[(3R)-2,5-dioxo-3-[N'-[(Z)-thiophen-2-ylmethylideneamino]carbamimidoyl]sulfanylpyrrolidin-1-yl]benzoic acid (PubChem CID 7098922) has the molecular formula C17H14N4O4S2 and a molecular weight of 402.46 g/mol. Its IUPAC name is 3-[(3R)-2,5-dioxo-3-[N'-[(Z)-thiophen-2-ylmethylideneamino]carbamimidoyl]sulfanylpyrrolidin-1-yl]benzoic acid.
| Compound Name | 3-[(3R)-2,5-dioxo-3-[N'-[(Z)-thiophen-2-ylmethylideneamino]carbamimidoyl]sulfanylpyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 7098922 |
| Molecular Formula | C17H14N4O4S2 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 3-[(3R)-2,5-dioxo-3-[N'-[(Z)-thiophen-2-ylmethylideneamino]carbamimidoyl]sulfanylpyrrolidin-1-yl]benzoic acid |
| SMILES | NC(=N/N=C\c1cccs1)S[C@@H]1CC(=O)N(c2cccc(C(=O)O)c2)C1=O |
| InChI | InChI=1S/C17H14N4O4S2/c18-17(20-19-9-12-5-2-6-26-12)27-13-8-14(22)21(15(13)23)11-4-1-3-10(7-11)16(24)25/h1-7,9,13H,8H2,(H2,18,20)(H,24,25)/b19-9-/t13-/m1/s1 |
| InChIKey | KSBPLARJAWFBPX-JFPGXGMNSA-N |
| XLogP | 2.16 |
| TPSA | 125.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|