C23H24ClN5O2S — CID 26451407
[(3S)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-[(E)-4-[4-(dimethylamino)phenyl]but-3-en-2-ylidene]amino]carbamimidothioate (PubChem CID 26451407) has the molecular formula C23H24ClN5O2S and a molecular weight of 470.00 g/mol. Its IUPAC name is [(3S)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-[(E)-4-[4-(dimethylamino)phenyl]but-3-en-2-ylidene]amino]carbamimidothioate.
| Compound Name | [(3S)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-[(E)-4-[4-(dimethylamino)phenyl]but-3-en-2-ylidene]amino]carbamimidothioate |
|---|---|
| PubChem CID | 26451407 |
| Molecular Formula | C23H24ClN5O2S |
| Molecular Weight | 470.00 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | [(3S)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-[(Z)-[(E)-4-[4-(dimethylamino)phenyl]but-3-en-2-ylidene]amino]carbamimidothioate |
| SMILES | CC(/C=C/c1ccc(N(C)C)cc1)=N/N=C(N)S[C@H]1CC(=O)N(c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C23H24ClN5O2S/c1-15(7-8-16-9-11-18(12-10-16)28(2)3)26-27-23(25)32-20-14-21(30)29(22(20)31)19-6-4-5-17(24)13-19/h4-13,20H,14H2,1-3H3,(H2,25,27)/b8-7+,26-15-/t20-/m0/s1 |
| InChIKey | RVJLNHDWNQZOOR-RCZYPBSHSA-N |
| XLogP | 4.18 |
| TPSA | 91.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.00 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|