C21H16ClN3O2S — CID 6553341
[(3R)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-naphthalen-2-ylcarbamimidothioate (PubChem CID 6553341) has the molecular formula C21H16ClN3O2S and a molecular weight of 409.90 g/mol. Its IUPAC name is [(3R)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-naphthalen-2-ylcarbamimidothioate.
| Compound Name | [(3R)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-naphthalen-2-ylcarbamimidothioate |
|---|---|
| PubChem CID | 6553341 |
| Molecular Formula | C21H16ClN3O2S |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | [(3R)-1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-naphthalen-2-ylcarbamimidothioate |
| SMILES | N/C(=N\c1ccc2ccccc2c1)S[C@@H]1CC(=O)N(c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C21H16ClN3O2S/c22-15-6-3-7-17(11-15)25-19(26)12-18(20(25)27)28-21(23)24-16-9-8-13-4-1-2-5-14(13)10-16/h1-11,18H,12H2,(H2,23,24)/t18-/m1/s1 |
| InChIKey | IXBAELKGHIHFIV-GOSISDBHSA-N |
| XLogP | 4.50 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|