C15H18N4O4S — CID 6558438
[(3R)-1-(3-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-acetamidocarbamimidothioate (PubChem CID 6558438) has the molecular formula C15H18N4O4S and a molecular weight of 350.40 g/mol. Its IUPAC name is [(3R)-1-(3-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-acetamidocarbamimidothioate.
| Compound Name | [(3R)-1-(3-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-acetamidocarbamimidothioate |
|---|---|
| PubChem CID | 6558438 |
| Molecular Formula | C15H18N4O4S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | [(3R)-1-(3-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-acetamidocarbamimidothioate |
| SMILES | CCOc1cccc(N2C(=O)C[C@@H](S/C(N)=N\NC(C)=O)C2=O)c1 |
| InChI | InChI=1S/C15H18N4O4S/c1-3-23-11-6-4-5-10(7-11)19-13(21)8-12(14(19)22)24-15(16)18-17-9(2)20/h4-7,12H,3,8H2,1-2H3,(H2,16,18)(H,17,20)/t12-/m1/s1 |
| InChIKey | CPWFWCNDJMRGBG-GFCCVEGCSA-N |
| XLogP | 0.82 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|