C19H19ClN4O3S2 — CID 2882241
[1-(3-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-[1-(5-chlorothiophen-2-yl)ethylideneamino]carbamimidothioate (PubChem CID 2882241) has the molecular formula C19H19ClN4O3S2 and a molecular weight of 450.97 g/mol. Its IUPAC name is [1-(3-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-[1-(5-chlorothiophen-2-yl)ethylideneamino]carbamimidothioate.
| Compound Name | [1-(3-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-[1-(5-chlorothiophen-2-yl)ethylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 2882241 |
| Molecular Formula | C19H19ClN4O3S2 |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | [1-(3-ethoxyphenyl)-2,5-dioxopyrrolidin-3-yl] N'-[1-(5-chlorothiophen-2-yl)ethylideneamino]carbamimidothioate |
| SMILES | CCOc1cccc(N2C(=O)CC(SC(N)=NN=C(C)c3ccc(Cl)s3)C2=O)c1 |
| InChI | InChI=1S/C19H19ClN4O3S2/c1-3-27-13-6-4-5-12(9-13)24-17(25)10-15(18(24)26)29-19(21)23-22-11(2)14-7-8-16(20)28-14/h4-9,15H,3,10H2,1-2H3,(H2,21,23) |
| InChIKey | MJUHAHROKQIVMA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 97.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|