C19H18ClN3O2S — CID 3971422
[1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-(3,4-dimethylphenyl)carbamimidothioate (PubChem CID 3971422) has the molecular formula C19H18ClN3O2S and a molecular weight of 387.89 g/mol. Its IUPAC name is [1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-(3,4-dimethylphenyl)carbamimidothioate.
| Compound Name | [1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-(3,4-dimethylphenyl)carbamimidothioate |
|---|---|
| PubChem CID | 3971422 |
| Molecular Formula | C19H18ClN3O2S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | [1-(3-chlorophenyl)-2,5-dioxopyrrolidin-3-yl] N'-(3,4-dimethylphenyl)carbamimidothioate |
| SMILES | Cc1ccc(/N=C(\N)SC2CC(=O)N(c3cccc(Cl)c3)C2=O)cc1C |
| InChI | InChI=1S/C19H18ClN3O2S/c1-11-6-7-14(8-12(11)2)22-19(21)26-16-10-17(24)23(18(16)25)15-5-3-4-13(20)9-15/h3-9,16H,10H2,1-2H3,(H2,21,22) |
| InChIKey | MZWJWQZAXGVCMD-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|