C12H11NO4 — CID 7026148
3-[(3R)-3-methyl-2,5-dioxopyrrolidin-1-yl]benzoic acid (PubChem CID 7026148) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 3-[(3R)-3-methyl-2,5-dioxopyrrolidin-1-yl]benzoic acid.
| Compound Name | 3-[(3R)-3-methyl-2,5-dioxopyrrolidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 7026148 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 3-[(3R)-3-methyl-2,5-dioxopyrrolidin-1-yl]benzoic acid |
| SMILES | C[C@@H]1CC(=O)N(c2cccc(C(=O)O)c2)C1=O |
| InChI | InChI=1S/C12H11NO4/c1-7-5-10(14)13(11(7)15)9-4-2-3-8(6-9)12(16)17/h2-4,6-7H,5H2,1H3,(H,16,17)/t7-/m1/s1 |
| InChIKey | XYGODKUTURWIHD-SSDOTTSWSA-N |
| XLogP | 1.28 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|