C14H13NO4 — CID 109375063
(E)-3-[3-(3-methyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoic acid (PubChem CID 109375063) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is (E)-3-[3-(3-methyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(3-methyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 109375063 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (E)-3-[3-(3-methyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoic acid |
| SMILES | CC1CC(=O)N(c2cccc(/C=C/C(=O)O)c2)C1=O |
| InChI | InChI=1S/C14H13NO4/c1-9-7-12(16)15(14(9)19)11-4-2-3-10(8-11)5-6-13(17)18/h2-6,8-9H,7H2,1H3,(H,17,18)/b6-5+ |
| InChIKey | AIFJYGRMGBMKCQ-AATRIKPKSA-N |
| XLogP | 1.68 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|