C20H17NO4 — CID 3494837
3-[3-(3-benzyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoic acid (PubChem CID 3494837) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is 3-[3-(3-benzyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-(3-benzyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 3494837 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 3-[3-(3-benzyl-2,5-dioxopyrrolidin-1-yl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cccc(N2C(=O)CC(Cc3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C20H17NO4/c22-18-13-16(11-14-5-2-1-3-6-14)20(25)21(18)17-8-4-7-15(12-17)9-10-19(23)24/h1-10,12,16H,11,13H2,(H,23,24) |
| InChIKey | JKKQCBJRXUMCQL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|