C20H16BrNO3 — CID 139259739
(3S)-3-[(E)-4-(4-bromophenyl)-2-oxobut-3-enyl]-1-phenylpyrrolidine-2,5-dione (PubChem CID 139259739) has the molecular formula C20H16BrNO3 and a molecular weight of 398.26 g/mol. Its IUPAC name is (3S)-3-[(E)-4-(4-bromophenyl)-2-oxobut-3-enyl]-1-phenylpyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[(E)-4-(4-bromophenyl)-2-oxobut-3-enyl]-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 139259739 |
| Molecular Formula | C20H16BrNO3 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | (3S)-3-[(E)-4-(4-bromophenyl)-2-oxobut-3-enyl]-1-phenylpyrrolidine-2,5-dione |
| SMILES | O=C(/C=C/c1ccc(Br)cc1)C[C@H]1CC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C20H16BrNO3/c21-16-9-6-14(7-10-16)8-11-18(23)12-15-13-19(24)22(20(15)25)17-4-2-1-3-5-17/h1-11,15H,12-13H2/b11-8+/t15-/m0/s1 |
| InChIKey | HWIGOPBSEHAZSZ-SHQCLWGWSA-N |
| XLogP | 4.00 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|